C16H27FO3Si — CID 10710401
methyl (2Z)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-2-methylidenecyclohexylidene]acetate (PubChem CID 10710401) has the molecular formula C16H27FO3Si and a molecular weight of 314.47 g/mol. Its IUPAC name is methyl (2Z)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-2-methylidenecyclohexylidene]acetate.
| Compound Name | methyl (2Z)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-2-methylidenecyclohexylidene]acetate |
|---|---|
| PubChem CID | 10710401 |
| Molecular Formula | C16H27FO3Si |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | methyl (2Z)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-2-methylidenecyclohexylidene]acetate |
| SMILES | C=C1/C(=C\C(=O)OC)C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1F |
| InChI | InChI=1S/C16H27FO3Si/c1-11-12(9-15(18)19-5)8-13(10-14(11)17)20-21(6,7)16(2,3)4/h9,13-14H,1,8,10H2,2-7H3/b12-9-/t13-,14+/m1/s1 |
| InChIKey | QDLVLZLFCAFGIE-CUSVYIHLSA-N |
| XLogP | 4.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|