C19H33FO3Si — CID 10546208
ethyl (2E)-2-[(3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(2-fluoroethyl)-2-methylidenecyclohexylidene]acetate (PubChem CID 10546208) has the molecular formula C19H33FO3Si and a molecular weight of 356.55 g/mol. Its IUPAC name is ethyl (2E)-2-[(3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(2-fluoroethyl)-2-methylidenecyclohexylidene]acetate.
| Compound Name | ethyl (2E)-2-[(3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(2-fluoroethyl)-2-methylidenecyclohexylidene]acetate |
|---|---|
| PubChem CID | 10546208 |
| Molecular Formula | C19H33FO3Si |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | ethyl (2E)-2-[(3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(2-fluoroethyl)-2-methylidenecyclohexylidene]acetate |
| SMILES | C=C1/C(=C/C(=O)OCC)C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1CCF |
| InChI | InChI=1S/C19H33FO3Si/c1-8-22-18(21)13-16-12-17(11-15(9-10-20)14(16)2)23-24(6,7)19(3,4)5/h13,15,17H,2,8-12H2,1,3-7H3/b16-13+/t15-,17-/m0/s1 |
| InChIKey | JHCVIJRJUGPPPQ-JQVFANFKSA-N |
| XLogP | 5.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|