C19H22S2+2 — CID 101370833
[(15S)-15-ethyl-15-methyl-8-sulfaniumyl-1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]sulfanium (PubChem CID 101370833) has the molecular formula C19H22S2+2 and a molecular weight of 314.52 g/mol. Its IUPAC name is [(15S)-15-ethyl-15-methyl-8-sulfaniumyl-1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]sulfanium.
| Compound Name | [(15S)-15-ethyl-15-methyl-8-sulfaniumyl-1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]sulfanium |
|---|---|
| PubChem CID | 101370833 |
| Molecular Formula | C19H22S2+2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | [(15S)-15-ethyl-15-methyl-8-sulfaniumyl-1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]sulfanium |
| SMILES | CC[C@@]1(C)CC2([SH2+])c3ccccc3C1([SH2+])c1ccccc12 |
| InChI | InChI=1S/C19H20S2/c1-3-17(2)12-18(20)13-8-4-6-10-15(13)19(17,21)16-11-7-5-9-14(16)18/h4-11,20-21H,3,12H2,1-2H3/p+2/t17-,18?,19?/m0/s1 |
| InChIKey | OREXRJHQGDYKRL-VIQWUECVSA-P |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|