C23H30OSi — CID 101370975
(1S,2S)-2-cyclopentyl-3-[dimethyl(phenyl)silyl]-1-phenylbut-3-en-1-ol (PubChem CID 101370975) has the molecular formula C23H30OSi and a molecular weight of 350.58 g/mol. Its IUPAC name is (1S,2S)-2-cyclopentyl-3-[dimethyl(phenyl)silyl]-1-phenylbut-3-en-1-ol.
| Compound Name | (1S,2S)-2-cyclopentyl-3-[dimethyl(phenyl)silyl]-1-phenylbut-3-en-1-ol |
|---|---|
| PubChem CID | 101370975 |
| Molecular Formula | C23H30OSi |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (1S,2S)-2-cyclopentyl-3-[dimethyl(phenyl)silyl]-1-phenylbut-3-en-1-ol |
| SMILES | C=C([C@@H](C1CCCC1)[C@H](O)c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C23H30OSi/c1-18(25(2,3)21-16-8-5-9-17-21)22(19-12-10-11-13-19)23(24)20-14-6-4-7-15-20/h4-9,14-17,19,22-24H,1,10-13H2,2-3H3/t22-,23+/m0/s1 |
| InChIKey | JPWGOXSQPWIZSV-XZOQPEGZSA-N |
| XLogP | 5.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|