C28H40O5 — CID 101372822
(4S,5S)-5-[hydroxy-[(2S,3S)-3-[4-[(4-methoxyphenyl)methoxy]butyl]oxiran-2-yl]methyl]-4-[(Z)-oct-2-enyl]cyclopent-2-en-1-one (PubChem CID 101372822) has the molecular formula C28H40O5 and a molecular weight of 456.62 g/mol. Its IUPAC name is (4S,5S)-5-[hydroxy-[(2S,3S)-3-[4-[(4-methoxyphenyl)methoxy]butyl]oxiran-2-yl]methyl]-4-[(Z)-oct-2-enyl]cyclopent-2-en-1-one.
| Compound Name | (4S,5S)-5-[hydroxy-[(2S,3S)-3-[4-[(4-methoxyphenyl)methoxy]butyl]oxiran-2-yl]methyl]-4-[(Z)-oct-2-enyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 101372822 |
| Molecular Formula | C28H40O5 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | (4S,5S)-5-[hydroxy-[(2S,3S)-3-[4-[(4-methoxyphenyl)methoxy]butyl]oxiran-2-yl]methyl]-4-[(Z)-oct-2-enyl]cyclopent-2-en-1-one |
| SMILES | CCCCC/C=C\C[C@H]1C=CC(=O)[C@@H]1C(O)[C@@H]1O[C@H]1CCCCOCc1ccc(OC)cc1 |
| InChI | InChI=1S/C28H40O5/c1-3-4-5-6-7-8-11-22-15-18-24(29)26(22)27(30)28-25(33-28)12-9-10-19-32-20-21-13-16-23(31-2)17-14-21/h7-8,13-18,22,25-28,30H,3-6,9-12,19-20H2,1-2H3/b8-7-/t22-,25-,26+,27?,28+/m0/s1 |
| InChIKey | ZERQIXDWLVWEMJ-GDUANSKGSA-N |
| XLogP | 5.41 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|