C30H44O3 — CID 122660151
(4S)-4-[(Z)-7-[(4-methoxyphenyl)methoxy]hept-2-enyl]-5-[(Z,4S)-4-methylnon-6-en-2-yl]cyclopent-2-en-1-one (PubChem CID 122660151) has the molecular formula C30H44O3 and a molecular weight of 452.68 g/mol. Its IUPAC name is (4S)-4-[(Z)-7-[(4-methoxyphenyl)methoxy]hept-2-enyl]-5-[(Z,4S)-4-methylnon-6-en-2-yl]cyclopent-2-en-1-one.
| Compound Name | (4S)-4-[(Z)-7-[(4-methoxyphenyl)methoxy]hept-2-enyl]-5-[(Z,4S)-4-methylnon-6-en-2-yl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 122660151 |
| Molecular Formula | C30H44O3 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | (4S)-4-[(Z)-7-[(4-methoxyphenyl)methoxy]hept-2-enyl]-5-[(Z,4S)-4-methylnon-6-en-2-yl]cyclopent-2-en-1-one |
| SMILES | CC/C=C\C[C@H](C)CC(C)C1C(=O)C=C[C@@H]1C/C=C\CCCCOCc1ccc(OC)cc1 |
| InChI | InChI=1S/C30H44O3/c1-5-6-10-13-24(2)22-25(3)30-27(17-20-29(30)31)14-11-8-7-9-12-21-33-23-26-15-18-28(32-4)19-16-26/h6,8,10-11,15-20,24-25,27,30H,5,7,9,12-14,21-23H2,1-4H3/b10-6-,11-8-/t24-,25?,27-,30?/m0/s1 |
| InChIKey | USAPJZBVERRQMZ-GMEACDLXSA-N |
| XLogP | 7.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|