C29H42O4 — CID 122660147
(4S)-5-[(Z,3S)-1-hydroxy-3-methyloct-5-enyl]-4-[(Z)-7-[(4-methoxyphenyl)methoxy]hept-2-enyl]cyclopent-2-en-1-one (PubChem CID 122660147) has the molecular formula C29H42O4 and a molecular weight of 454.65 g/mol. Its IUPAC name is (4S)-5-[(Z,3S)-1-hydroxy-3-methyloct-5-enyl]-4-[(Z)-7-[(4-methoxyphenyl)methoxy]hept-2-enyl]cyclopent-2-en-1-one.
| Compound Name | (4S)-5-[(Z,3S)-1-hydroxy-3-methyloct-5-enyl]-4-[(Z)-7-[(4-methoxyphenyl)methoxy]hept-2-enyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 122660147 |
| Molecular Formula | C29H42O4 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | (4S)-5-[(Z,3S)-1-hydroxy-3-methyloct-5-enyl]-4-[(Z)-7-[(4-methoxyphenyl)methoxy]hept-2-enyl]cyclopent-2-en-1-one |
| SMILES | CC/C=C\C[C@H](C)CC(O)C1C(=O)C=C[C@@H]1C/C=C\CCCCOCc1ccc(OC)cc1 |
| InChI | InChI=1S/C29H42O4/c1-4-5-9-12-23(2)21-28(31)29-25(16-19-27(29)30)13-10-7-6-8-11-20-33-22-24-14-17-26(32-3)18-15-24/h5,7,9-10,14-19,23,25,28-29,31H,4,6,8,11-13,20-22H2,1-3H3/b9-5-,10-7-/t23-,25-,28?,29?/m0/s1 |
| InChIKey | BTAQGGICSFVBIV-DOMURAHASA-N |
| XLogP | 6.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|