C26H34O5 — CID 101233356
(E,2S)-8-[(2S,3R)-3-[(4-methoxyphenyl)methoxymethyl]oxiran-2-yl]-1-phenylmethoxyoct-6-en-2-ol (PubChem CID 101233356) has the molecular formula C26H34O5 and a molecular weight of 426.55 g/mol. Its IUPAC name is (E,2S)-8-[(2S,3R)-3-[(4-methoxyphenyl)methoxymethyl]oxiran-2-yl]-1-phenylmethoxyoct-6-en-2-ol.
| Compound Name | (E,2S)-8-[(2S,3R)-3-[(4-methoxyphenyl)methoxymethyl]oxiran-2-yl]-1-phenylmethoxyoct-6-en-2-ol |
|---|---|
| PubChem CID | 101233356 |
| Molecular Formula | C26H34O5 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | (E,2S)-8-[(2S,3R)-3-[(4-methoxyphenyl)methoxymethyl]oxiran-2-yl]-1-phenylmethoxyoct-6-en-2-ol |
| SMILES | COc1ccc(COC[C@H]2O[C@H]2C/C=C/CCC[C@H](O)COCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H34O5/c1-28-24-15-13-22(14-16-24)18-30-20-26-25(31-26)12-8-3-2-7-11-23(27)19-29-17-21-9-5-4-6-10-21/h3-6,8-10,13-16,23,25-27H,2,7,11-12,17-20H2,1H3/b8-3+/t23-,25-,26+/m0/s1 |
| InChIKey | QDVGKINVEFHXJH-QWPJCFRBSA-N |
| XLogP | 4.67 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|