C24H50N2O10S4Si2 — CID 101373824
1-O,4-O-bis[1-sulfanyl-3-(3-trimethoxysilylpropoxy)propan-2-yl] piperazine-1,4-dicarbothioate (PubChem CID 101373824) has the molecular formula C24H50N2O10S4Si2 and a molecular weight of 711.11 g/mol. Its IUPAC name is 1-O,4-O-bis[1-sulfanyl-3-(3-trimethoxysilylpropoxy)propan-2-yl] piperazine-1,4-dicarbothioate.
| Compound Name | 1-O,4-O-bis[1-sulfanyl-3-(3-trimethoxysilylpropoxy)propan-2-yl] piperazine-1,4-dicarbothioate |
|---|---|
| PubChem CID | 101373824 |
| Molecular Formula | C24H50N2O10S4Si2 |
| Molecular Weight | 711.11 g/mol |
| Exact Mass | 710.19 |
| IUPAC Name | 1-O,4-O-bis[1-sulfanyl-3-(3-trimethoxysilylpropoxy)propan-2-yl] piperazine-1,4-dicarbothioate |
| SMILES | CO[Si](CCCOCC(CS)OC(=S)N1CCN(C(=S)OC(CS)COCCC[Si](OC)(OC)OC)CC1)(OC)OC |
| InChI | InChI=1S/C24H50N2O10S4Si2/c1-27-41(28-2,29-3)15-7-13-33-17-21(19-37)35-23(39)25-9-11-26(12-10-25)24(40)36-22(20-38)18-34-14-8-16-42(30-4,31-5)32-6/h21-22,37-38H,7-20H2,1-6H3 |
| InChIKey | UTHYMEYMKPFZQE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.11 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|