C15H12F6N+ — CID 101373998
[4-(trifluoromethyl)phenyl]-[[4-(trifluoromethyl)phenyl]methyl]azanium (PubChem CID 101373998) has the molecular formula C15H12F6N+ and a molecular weight of 320.26 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl]-[[4-(trifluoromethyl)phenyl]methyl]azanium.
| Compound Name | [4-(trifluoromethyl)phenyl]-[[4-(trifluoromethyl)phenyl]methyl]azanium |
|---|---|
| PubChem CID | 101373998 |
| Molecular Formula | C15H12F6N+ |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | [4-(trifluoromethyl)phenyl]-[[4-(trifluoromethyl)phenyl]methyl]azanium |
| SMILES | FC(F)(F)c1ccc(C[NH2+]c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C15H11F6N/c16-14(17,18)11-3-1-10(2-4-11)9-22-13-7-5-12(6-8-13)15(19,20)21/h1-8,22H,9H2/p+1 |
| InChIKey | ZBLMCIWIFLHUCE-UHFFFAOYSA-O |
| XLogP | 4.12 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|