C16H14F12NP — CID 53342060
bis[[4-(trifluoromethyl)phenyl]methyl]azanium hexafluorophosphate (PubChem CID 53342060) has the molecular formula C16H14F12NP and a molecular weight of 479.25 g/mol. Its IUPAC name is bis[[4-(trifluoromethyl)phenyl]methyl]azanium hexafluorophosphate.
| Compound Name | bis[[4-(trifluoromethyl)phenyl]methyl]azanium hexafluorophosphate |
|---|---|
| PubChem CID | 53342060 |
| Molecular Formula | C16H14F12NP |
| Molecular Weight | 479.25 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | bis[[4-(trifluoromethyl)phenyl]methyl]azanium hexafluorophosphate |
| SMILES | FC(F)(F)c1ccc(C[NH2+]Cc2ccc(C(F)(F)F)cc2)cc1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C16H13F6N.F6P/c17-15(18,19)13-5-1-11(2-6-13)9-23-10-12-3-7-14(8-4-12)16(20,21)22;1-7(2,3,4,5)6/h1-8,23H,9-10H2;/q;-1/p+1 |
| InChIKey | NBPYXKHWZYAYFD-UHFFFAOYSA-O |
| XLogP | 7.37 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.25 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|