C20H27N3O4P2 — CID 101374073
2-but-3-en-2-yloxy-2-diphenoxyphosphorylimino-1,3-dimethyl-1,3,2λ5-diazaphospholidine (PubChem CID 101374073) has the molecular formula C20H27N3O4P2 and a molecular weight of 435.40 g/mol. Its IUPAC name is 2-but-3-en-2-yloxy-2-diphenoxyphosphorylimino-1,3-dimethyl-1,3,2λ5-diazaphospholidine.
| Compound Name | 2-but-3-en-2-yloxy-2-diphenoxyphosphorylimino-1,3-dimethyl-1,3,2λ5-diazaphospholidine |
|---|---|
| PubChem CID | 101374073 |
| Molecular Formula | C20H27N3O4P2 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 2-but-3-en-2-yloxy-2-diphenoxyphosphorylimino-1,3-dimethyl-1,3,2λ5-diazaphospholidine |
| SMILES | C=CC(C)OP1(=NP(=O)(Oc2ccccc2)Oc2ccccc2)N(C)CCN1C |
| InChI | InChI=1S/C20H27N3O4P2/c1-5-18(2)25-28(22(3)16-17-23(28)4)21-29(24,26-19-12-8-6-9-13-19)27-20-14-10-7-11-15-20/h5-15,18H,1,16-17H2,2-4H3 |
| InChIKey | QIULPVZJIRAXLL-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|