C29H51NO5Si2 — CID 101374564
(1R,4R,5S,6S)-7-benzyl-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3,8-dioxa-7-azabicyclo[4.3.1]decan-10-one (PubChem CID 101374564) has the molecular formula C29H51NO5Si2 and a molecular weight of 549.90 g/mol. Its IUPAC name is (1R,4R,5S,6S)-7-benzyl-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3,8-dioxa-7-azabicyclo[4.3.1]decan-10-one.
| Compound Name | (1R,4R,5S,6S)-7-benzyl-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3,8-dioxa-7-azabicyclo[4.3.1]decan-10-one |
|---|---|
| PubChem CID | 101374564 |
| Molecular Formula | C29H51NO5Si2 |
| Molecular Weight | 549.90 g/mol |
| Exact Mass | 549.33 |
| IUPAC Name | (1R,4R,5S,6S)-7-benzyl-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3,8-dioxa-7-azabicyclo[4.3.1]decan-10-one |
| SMILES | CC1(C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2C(=O)[C@@H]1CON2Cc1ccccc1 |
| InChI | InChI=1S/C29H51NO5Si2/c1-27(2,3)36(9,10)33-20-23-26(35-37(11,12)28(4,5)6)24-25(31)22(29(7,8)34-23)19-32-30(24)18-21-16-14-13-15-17-21/h13-17,22-24,26H,18-20H2,1-12H3/t22-,23+,24+,26+/m0/s1 |
| InChIKey | USJQHKJHKFTNDT-POMLREGLSA-N |
| XLogP | 6.58 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.90 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|