C22H24N4O4 — CID 101380144
6-[[4-[[4-(prop-2-enoylamino)phenyl]diazenyl]benzoyl]amino]hexanoic acid (PubChem CID 101380144) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is 6-[[4-[[4-(prop-2-enoylamino)phenyl]diazenyl]benzoyl]amino]hexanoic acid.
| Compound Name | 6-[[4-[[4-(prop-2-enoylamino)phenyl]diazenyl]benzoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 101380144 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 6-[[4-[[4-(prop-2-enoylamino)phenyl]diazenyl]benzoyl]amino]hexanoic acid |
| SMILES | C=CC(=O)Nc1ccc(/N=N/c2ccc(C(=O)NCCCCCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C22H24N4O4/c1-2-20(27)24-17-11-13-19(14-12-17)26-25-18-9-7-16(8-10-18)22(30)23-15-5-3-4-6-21(28)29/h2,7-14H,1,3-6,15H2,(H,23,30)(H,24,27)(H,28,29)/b26-25+ |
| InChIKey | QTWDSUZFJMZQPZ-OCEACIFDSA-N |
| XLogP | 4.60 |
| TPSA | 120.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|