C21H23N3O5 — CID 176697392
6-[[3,5-bis(buta-2,3-dienoylamino)benzoyl]amino]hexanoic acid (PubChem CID 176697392) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is 6-[[3,5-bis(buta-2,3-dienoylamino)benzoyl]amino]hexanoic acid.
| Compound Name | 6-[[3,5-bis(buta-2,3-dienoylamino)benzoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 176697392 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 6-[[3,5-bis(buta-2,3-dienoylamino)benzoyl]amino]hexanoic acid |
| SMILES | C=C=CC(=O)Nc1cc(NC(=O)C=C=C)cc(C(=O)NCCCCCC(=O)O)c1 |
| InChI | InChI=1S/C21H23N3O5/c1-3-8-18(25)23-16-12-15(13-17(14-16)24-19(26)9-4-2)21(29)22-11-7-5-6-10-20(27)28/h8-9,12-14H,1-2,5-7,10-11H2,(H,22,29)(H,23,25)(H,24,26)(H,27,28) |
| InChIKey | FEZLPWOSNOMPGU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|