C28H30O4 — CID 101380709
bis(2-phenylethyl) 6-methyl-4-methylidene-1,3,3a,5-tetrahydropentalene-2,2-dicarboxylate (PubChem CID 101380709) has the molecular formula C28H30O4 and a molecular weight of 430.54 g/mol. Its IUPAC name is bis(2-phenylethyl) 6-methyl-4-methylidene-1,3,3a,5-tetrahydropentalene-2,2-dicarboxylate.
| Compound Name | bis(2-phenylethyl) 6-methyl-4-methylidene-1,3,3a,5-tetrahydropentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 101380709 |
| Molecular Formula | C28H30O4 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | bis(2-phenylethyl) 6-methyl-4-methylidene-1,3,3a,5-tetrahydropentalene-2,2-dicarboxylate |
| SMILES | C=C1CC(C)=C2CC(C(=O)OCCc3ccccc3)(C(=O)OCCc3ccccc3)CC12 |
| InChI | InChI=1S/C28H30O4/c1-20-17-21(2)25-19-28(18-24(20)25,26(29)31-15-13-22-9-5-3-6-10-22)27(30)32-16-14-23-11-7-4-8-12-23/h3-12,24H,1,13-19H2,2H3 |
| InChIKey | IIJXHIADVSDPPW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|