C14H20O5 — CID 101382182
1-O-tert-butyl 5-O-methyl (E,4E)-4-(oxolan-2-ylidene)pent-2-enedioate (PubChem CID 101382182) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-methyl (E,4E)-4-(oxolan-2-ylidene)pent-2-enedioate.
| Compound Name | 1-O-tert-butyl 5-O-methyl (E,4E)-4-(oxolan-2-ylidene)pent-2-enedioate |
|---|---|
| PubChem CID | 101382182 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 1-O-tert-butyl 5-O-methyl (E,4E)-4-(oxolan-2-ylidene)pent-2-enedioate |
| SMILES | COC(=O)C(/C=C/C(=O)OC(C)(C)C)=C1\CCCO1 |
| InChI | InChI=1S/C14H20O5/c1-14(2,3)19-12(15)8-7-10(13(16)17-4)11-6-5-9-18-11/h7-8H,5-6,9H2,1-4H3/b8-7+,11-10+ |
| InChIKey | WOXJKDMTRVKIGK-ZDVGBALWSA-N |
| XLogP | 2.12 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|