C21H26N2O — CID 101383238
(1S,8S,9R)-8-butyl-10,10-dimethyl-5-pyridin-2-yl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-8-ol (PubChem CID 101383238) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is (1S,8S,9R)-8-butyl-10,10-dimethyl-5-pyridin-2-yl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-8-ol.
| Compound Name | (1S,8S,9R)-8-butyl-10,10-dimethyl-5-pyridin-2-yl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-8-ol |
|---|---|
| PubChem CID | 101383238 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (1S,8S,9R)-8-butyl-10,10-dimethyl-5-pyridin-2-yl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-8-ol |
| SMILES | CCCC[C@@]1(O)c2nc(-c3ccccn3)ccc2[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C21H26N2O/c1-4-5-11-21(24)18-13-15(20(18,2)3)14-9-10-17(23-19(14)21)16-8-6-7-12-22-16/h6-10,12,15,18,24H,4-5,11,13H2,1-3H3/t15-,18-,21+/m1/s1 |
| InChIKey | FZYXUSPFIDHEPH-FPDPHYFHSA-N |
| XLogP | 4.66 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |