C17H19N3 — CID 102288486
(1S,8S,9R)-10,10-dimethyl-5-pyridin-2-yl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-8-amine (PubChem CID 102288486) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is (1S,8S,9R)-10,10-dimethyl-5-pyridin-2-yl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-8-amine.
| Compound Name | (1S,8S,9R)-10,10-dimethyl-5-pyridin-2-yl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-8-amine |
|---|---|
| PubChem CID | 102288486 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | (1S,8S,9R)-10,10-dimethyl-5-pyridin-2-yl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-8-amine |
| SMILES | CC1(C)[C@@H]2C[C@H]1[C@H](N)c1nc(-c3ccccn3)ccc12 |
| InChI | InChI=1S/C17H19N3/c1-17(2)11-9-12(17)15(18)16-10(11)6-7-14(20-16)13-5-3-4-8-19-13/h3-8,11-12,15H,9,18H2,1-2H3/t11-,12+,15+/m1/s1 |
| InChIKey | UEFVCAMFKRLNPW-XUJVJEKNSA-N |
| XLogP | 3.29 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |