C31H30NP — CID 58626968
diphenyl-[2-[(1R,8R,9R)-8,10,10-trimethyl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-5-yl]phenyl]phosphane (PubChem CID 58626968) has the molecular formula C31H30NP and a molecular weight of 447.56 g/mol. Its IUPAC name is diphenyl-[2-[(1R,8R,9R)-8,10,10-trimethyl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-5-yl]phenyl]phosphane.
| Compound Name | diphenyl-[2-[(1R,8R,9R)-8,10,10-trimethyl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-5-yl]phenyl]phosphane |
|---|---|
| PubChem CID | 58626968 |
| Molecular Formula | C31H30NP |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | diphenyl-[2-[(1R,8R,9R)-8,10,10-trimethyl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-5-yl]phenyl]phosphane |
| SMILES | C[C@H]1c2nc(-c3ccccc3P(c3ccccc3)c3ccccc3)ccc2[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C31H30NP/c1-21-26-20-27(31(26,2)3)24-18-19-28(32-30(21)24)25-16-10-11-17-29(25)33(22-12-6-4-7-13-22)23-14-8-5-9-15-23/h4-19,21,26-27H,20H2,1-3H3/t21-,26-,27+/m1/s1 |
| InChIKey | YMNXEINNYGBNMV-ZFWHIUCFSA-N |
| XLogP | 6.75 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|