C16H22O3 — CID 101386194
(1S,3R,5R,6R,7S,9R)-5,9-diacetyl-1,3-dimethyltricyclo[4.3.1.03,7]decan-2-one (PubChem CID 101386194) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (1S,3R,5R,6R,7S,9R)-5,9-diacetyl-1,3-dimethyltricyclo[4.3.1.03,7]decan-2-one.
| Compound Name | (1S,3R,5R,6R,7S,9R)-5,9-diacetyl-1,3-dimethyltricyclo[4.3.1.03,7]decan-2-one |
|---|---|
| PubChem CID | 101386194 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (1S,3R,5R,6R,7S,9R)-5,9-diacetyl-1,3-dimethyltricyclo[4.3.1.03,7]decan-2-one |
| SMILES | CC(=O)[C@@H]1C[C@@]2(C)C(=O)[C@@]3(C)C[C@@H]1[C@@H]2C[C@H]3C(C)=O |
| InChI | InChI=1S/C16H22O3/c1-8(17)10-6-16(4)13-5-12(9(2)18)15(3,14(16)19)7-11(10)13/h10-13H,5-7H2,1-4H3/t10-,11-,12-,13-,15-,16+/m0/s1 |
| InChIKey | SDYDWDICDZSLSB-JKPJVAMOSA-N |
| XLogP | 2.42 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |