C16H22O — CID 10537452
(1R,3S,6R,7S)-1,3-dimethyl-8-methylidene-5-prop-1-en-2-yltricyclo[4.3.1.03,7]decan-2-one (PubChem CID 10537452) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is (1R,3S,6R,7S)-1,3-dimethyl-8-methylidene-5-prop-1-en-2-yltricyclo[4.3.1.03,7]decan-2-one.
| Compound Name | (1R,3S,6R,7S)-1,3-dimethyl-8-methylidene-5-prop-1-en-2-yltricyclo[4.3.1.03,7]decan-2-one |
|---|---|
| PubChem CID | 10537452 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (1R,3S,6R,7S)-1,3-dimethyl-8-methylidene-5-prop-1-en-2-yltricyclo[4.3.1.03,7]decan-2-one |
| SMILES | C=C(C)C1C[C@]2(C)C(=O)[C@@]3(C)CC(=C)[C@@H]2[C@@H]1C3 |
| InChI | InChI=1S/C16H22O/c1-9(2)11-8-16(5)13-10(3)6-15(4,14(16)17)7-12(11)13/h11-13H,1,3,6-8H2,2,4-5H3/t11?,12-,13-,15+,16+/m1/s1 |
| InChIKey | ASGLMPWYWDVRQY-YTUWIEPDSA-N |
| XLogP | 3.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|