C20H19N3O4 — CID 101390089
1-benzyl-4-morpholin-4-yl-1,4-benzodiazepine-2,3,5-trione (PubChem CID 101390089) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is 1-benzyl-4-morpholin-4-yl-1,4-benzodiazepine-2,3,5-trione.
| Compound Name | 1-benzyl-4-morpholin-4-yl-1,4-benzodiazepine-2,3,5-trione |
|---|---|
| PubChem CID | 101390089 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 1-benzyl-4-morpholin-4-yl-1,4-benzodiazepine-2,3,5-trione |
| SMILES | O=c1c(=O)n(Cc2ccccc2)c2ccccc2c(=O)n1N1CCOCC1 |
| InChI | InChI=1S/C20H19N3O4/c24-18-16-8-4-5-9-17(16)22(14-15-6-2-1-3-7-15)19(25)20(26)23(18)21-10-12-27-13-11-21/h1-9H,10-14H2 |
| InChIKey | JHXGCQYGPFPYHU-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 73.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|