C23H19N3O3 — CID 101390090
1-benzyl-4-(N-methylanilino)-1,4-benzodiazepine-2,3,5-trione (PubChem CID 101390090) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is 1-benzyl-4-(N-methylanilino)-1,4-benzodiazepine-2,3,5-trione.
| Compound Name | 1-benzyl-4-(N-methylanilino)-1,4-benzodiazepine-2,3,5-trione |
|---|---|
| PubChem CID | 101390090 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 1-benzyl-4-(N-methylanilino)-1,4-benzodiazepine-2,3,5-trione |
| SMILES | CN(c1ccccc1)n1c(=O)c(=O)n(Cc2ccccc2)c2ccccc2c1=O |
| InChI | InChI=1S/C23H19N3O3/c1-24(18-12-6-3-7-13-18)26-21(27)19-14-8-9-15-20(19)25(22(28)23(26)29)16-17-10-4-2-5-11-17/h2-15H,16H2,1H3 |
| InChIKey | YTDICJIPCRJNDM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 64.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|