C19H19NO4S — CID 101403022
methyl (1R,2R,10S,17S,18S)-14-oxo-19-oxa-3-thia-13-azahexacyclo[15.2.1.02,10.04,9.010,18.013,18]icosa-4,6,8-triene-1-carboxylate (PubChem CID 101403022) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is methyl (1R,2R,10S,17S,18S)-14-oxo-19-oxa-3-thia-13-azahexacyclo[15.2.1.02,10.04,9.010,18.013,18]icosa-4,6,8-triene-1-carboxylate.
| Compound Name | methyl (1R,2R,10S,17S,18S)-14-oxo-19-oxa-3-thia-13-azahexacyclo[15.2.1.02,10.04,9.010,18.013,18]icosa-4,6,8-triene-1-carboxylate |
|---|---|
| PubChem CID | 101403022 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | methyl (1R,2R,10S,17S,18S)-14-oxo-19-oxa-3-thia-13-azahexacyclo[15.2.1.02,10.04,9.010,18.013,18]icosa-4,6,8-triene-1-carboxylate |
| SMILES | COC(=O)[C@]12C[C@@H]3CCC(=O)N4CC[C@]5(c6ccccc6S[C@@H]15)[C@@]34O2 |
| InChI | InChI=1S/C19H19NO4S/c1-23-16(22)18-10-11-6-7-14(21)20-9-8-17(19(11,20)24-18)12-4-2-3-5-13(12)25-15(17)18/h2-5,11,15H,6-10H2,1H3/t11-,15+,17+,18-,19-/m0/s1 |
| InChIKey | UBWUDWYNPJSAIA-MPZMQPASSA-N |
| XLogP | 2.08 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |