C11H17FO — CID 101403613
(3S,6R)-6-cyclohexyl-3-fluoro-3,6-dihydro-2H-pyran (PubChem CID 101403613) has the molecular formula C11H17FO and a molecular weight of 184.25 g/mol. Its IUPAC name is (3S,6R)-6-cyclohexyl-3-fluoro-3,6-dihydro-2H-pyran.
| Compound Name | (3S,6R)-6-cyclohexyl-3-fluoro-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 101403613 |
| Molecular Formula | C11H17FO |
| Molecular Weight | 184.25 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | (3S,6R)-6-cyclohexyl-3-fluoro-3,6-dihydro-2H-pyran |
| SMILES | F[C@H]1C=C[C@@H](C2CCCCC2)OC1 |
| InChI | InChI=1S/C11H17FO/c12-10-6-7-11(13-8-10)9-4-2-1-3-5-9/h6-7,9-11H,1-5,8H2/t10-,11-/m0/s1 |
| InChIKey | QAWDMVQLGBMAFF-QWRGUYRKSA-N |
| XLogP | 2.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|