C19H21F3O4S — CID 101404875
(8R,9S,13S,14S)-3-hydroxy-13-methyl-2-(trifluoromethylsulfonyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 101404875) has the molecular formula C19H21F3O4S and a molecular weight of 402.43 g/mol. Its IUPAC name is (8R,9S,13S,14S)-3-hydroxy-13-methyl-2-(trifluoromethylsulfonyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-3-hydroxy-13-methyl-2-(trifluoromethylsulfonyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 101404875 |
| Molecular Formula | C19H21F3O4S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (8R,9S,13S,14S)-3-hydroxy-13-methyl-2-(trifluoromethylsulfonyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H]3c4cc(S(=O)(=O)C(F)(F)F)c(O)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C19H21F3O4S/c1-18-7-6-11-12(14(18)4-5-17(18)24)3-2-10-8-15(23)16(9-13(10)11)27(25,26)19(20,21)22/h8-9,11-12,14,23H,2-7H2,1H3/t11-,12+,14-,18-/m0/s1 |
| InChIKey | AFHJMTGZCIFKID-JPVZDGGYSA-N |
| XLogP | 4.11 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |