C23H20N2O3 — CID 101405797
N-[4-(1,3-dioxobenzo[e]isoindol-2-yl)phenyl]-2,2-dimethylpropanamide (PubChem CID 101405797) has the molecular formula C23H20N2O3 and a molecular weight of 372.42 g/mol. Its IUPAC name is N-[4-(1,3-dioxobenzo[e]isoindol-2-yl)phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-(1,3-dioxobenzo[e]isoindol-2-yl)phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 101405797 |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N-[4-(1,3-dioxobenzo[e]isoindol-2-yl)phenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc(N2C(=O)c3ccc4ccccc4c3C2=O)cc1 |
| InChI | InChI=1S/C23H20N2O3/c1-23(2,3)22(28)24-15-9-11-16(12-10-15)25-20(26)18-13-8-14-6-4-5-7-17(14)19(18)21(25)27/h4-13H,1-3H3,(H,24,28) |
| InChIKey | BINQDMZTHXDIQE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|