C20H12F10O3 — CID 10141189
(E)-1-[2,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-[3-fluoro-4-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 10141189) has the molecular formula C20H12F10O3 and a molecular weight of 490.29 g/mol. Its IUPAC name is (E)-1-[2,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-[3-fluoro-4-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[2,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-[3-fluoro-4-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 10141189 |
| Molecular Formula | C20H12F10O3 |
| Molecular Weight | 490.29 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | (E)-1-[2,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-[3-fluoro-4-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(C(F)(F)F)c(F)c1)c1cc(OCC(F)(F)F)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C20H12F10O3/c21-15-7-11(1-4-14(15)20(28,29)30)2-5-16(31)13-8-12(32-9-18(22,23)24)3-6-17(13)33-10-19(25,26)27/h1-8H,9-10H2/b5-2+ |
| InChIKey | QSXDBTFRASNKMY-GORDUTHDSA-N |
| XLogP | 6.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.29 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|