C13H18O2 — CID 101412626
(3R)-1-ethoxy-3-propan-2-yl-1,3-dihydro-2-benzofuran (PubChem CID 101412626) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (3R)-1-ethoxy-3-propan-2-yl-1,3-dihydro-2-benzofuran.
| Compound Name | (3R)-1-ethoxy-3-propan-2-yl-1,3-dihydro-2-benzofuran |
|---|---|
| PubChem CID | 101412626 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (3R)-1-ethoxy-3-propan-2-yl-1,3-dihydro-2-benzofuran |
| SMILES | CCOC1O[C@H](C(C)C)c2ccccc21 |
| InChI | InChI=1S/C13H18O2/c1-4-14-13-11-8-6-5-7-10(11)12(15-13)9(2)3/h5-9,12-13H,4H2,1-3H3/t12-,13?/m1/s1 |
| InChIKey | ONHNHZHEDUGCAM-PZORYLMUSA-N |
| XLogP | 3.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |