About Te-butyl N-butylcarbamotelluroate
Te-butyl N-butylcarbamotelluroate (PubChem CID 101413911) has the molecular formula C9H19NOTe
and a molecular weight of 284.86 g/mol. Its IUPAC name is Te-butyl N-butylcarbamotelluroate.
Molecular Properties
| Compound Name | Te-butyl N-butylcarbamotelluroate |
| PubChem CID | 101413911 |
| Molecular Formula | C9H19NOTe |
| Molecular Weight | 284.86 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | Te-butyl N-butylcarbamotelluroate |
| SMILES | CCCCNC(=O)[Te]CCCC |
| InChI | InChI=1S/C9H19NOTe/c1-3-5-7-10-9(11)12-8-6-4-2/h3-8H2,1-2H3,(H,10,11) |
| InChIKey | PMFAZBRWPRXIMA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.86 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Te-butyl N-butylcarbamotelluroate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Te-butyl N-butylcarbamotelluroate?
The IUPAC name of Te-butyl N-butylcarbamotelluroate (CID 101413911) is Te-butyl N-butylcarbamotelluroate.
What is the SMILES notation for Te-butyl N-butylcarbamotelluroate?
The canonical SMILES for Te-butyl N-butylcarbamotelluroate is CCCCNC(=O)[Te]CCCC.
What is the InChIKey of Te-butyl N-butylcarbamotelluroate?
The InChIKey is PMFAZBRWPRXIMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NOTe/c1-3-5-7-10-9(11)12-8-6-4-2/h3-8H2,1-2H3,(H,10,11).
What are the key properties of Te-butyl N-butylcarbamotelluroate?
Te-butyl N-butylcarbamotelluroate has a molecular weight of 284.86 g/mol, XLogP of 2.42, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Te-butyl N-butylcarbamotelluroate is sourced from PubChem (CID 101413911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).