C21H21N3O9 — CID 101414001
[(2R,3S,4S,5R,6S)-3,4-dihydroxy-5,6-bis(1H-pyrrole-2-carbonyloxy)oxan-2-yl]methyl 1H-pyrrole-2-carboxylate (PubChem CID 101414001) has the molecular formula C21H21N3O9 and a molecular weight of 459.41 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4-dihydroxy-5,6-bis(1H-pyrrole-2-carbonyloxy)oxan-2-yl]methyl 1H-pyrrole-2-carboxylate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4-dihydroxy-5,6-bis(1H-pyrrole-2-carbonyloxy)oxan-2-yl]methyl 1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 101414001 |
| Molecular Formula | C21H21N3O9 |
| Molecular Weight | 459.41 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4-dihydroxy-5,6-bis(1H-pyrrole-2-carbonyloxy)oxan-2-yl]methyl 1H-pyrrole-2-carboxylate |
| SMILES | O=C(OC[C@H]1O[C@@H](OC(=O)c2ccc[nH]2)[C@H](OC(=O)c2ccc[nH]2)[C@@H](O)[C@@H]1O)c1ccc[nH]1 |
| InChI | InChI=1S/C21H21N3O9/c25-15-14(10-30-18(27)11-4-1-7-22-11)31-21(33-20(29)13-6-3-9-24-13)17(16(15)26)32-19(28)12-5-2-8-23-12/h1-9,14-17,21-26H,10H2/t14-,15-,16+,17-,21+/m1/s1 |
| InChIKey | PEWLFUFCUXJGIA-IALVOCICSA-N |
| XLogP | 0.36 |
| TPSA | 175.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.41 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|