About (3,4,5-trihydroxy-6-methyloxan-2-yl) 1H-pyrrole-2-carboxylate
(3,4,5-trihydroxy-6-methyloxan-2-yl) 1H-pyrrole-2-carboxylate (PubChem CID 73205282) has the molecular formula C11H15NO6
and a molecular weight of 257.24 g/mol. Its IUPAC name is (3,4,5-trihydroxy-6-methyloxan-2-yl) 1H-pyrrole-2-carboxylate.
Analyze (3,4,5-trihydroxy-6-methyloxan-2-yl) 1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4,5-trihydroxy-6-methyloxan-2-yl) 1H-pyrrole-2-carboxylate?
The IUPAC name of (3,4,5-trihydroxy-6-methyloxan-2-yl) 1H-pyrrole-2-carboxylate (CID 73205282) is (3,4,5-trihydroxy-6-methyloxan-2-yl) 1H-pyrrole-2-carboxylate.
What is the SMILES notation for (3,4,5-trihydroxy-6-methyloxan-2-yl) 1H-pyrrole-2-carboxylate?
The canonical SMILES for (3,4,5-trihydroxy-6-methyloxan-2-yl) 1H-pyrrole-2-carboxylate is CC1OC(OC(=O)c2ccc[nH]2)C(O)C(O)C1O.
What is the InChIKey of (3,4,5-trihydroxy-6-methyloxan-2-yl) 1H-pyrrole-2-carboxylate?
The InChIKey is NQHXKPPRDVOFFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO6/c1-5-7(13)8(14)9(15)11(17-5)18-10(16)6-3-2-4-12-6/h2-5,7-9,11-15H,1H3.
What are the key properties of (3,4,5-trihydroxy-6-methyloxan-2-yl) 1H-pyrrole-2-carboxylate?
(3,4,5-trihydroxy-6-methyloxan-2-yl) 1H-pyrrole-2-carboxylate has a molecular weight of 257.24 g/mol, XLogP of -1.00, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4,5-trihydroxy-6-methyloxan-2-yl) 1H-pyrrole-2-carboxylate is sourced from PubChem (CID 73205282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).