C18H28N2O6 — CID 155545017
[(2R,3S,6S)-6-[(2S,3R,4R,6R)-4-amino-6-hydroxy-2,4-dimethyloxan-3-yl]oxy-2-methyloxan-3-yl] 1H-pyrrole-2-carboxylate (PubChem CID 155545017) has the molecular formula C18H28N2O6 and a molecular weight of 368.43 g/mol. Its IUPAC name is [(2R,3S,6S)-6-[(2S,3R,4R,6R)-4-amino-6-hydroxy-2,4-dimethyloxan-3-yl]oxy-2-methyloxan-3-yl] 1H-pyrrole-2-carboxylate.
| Compound Name | [(2R,3S,6S)-6-[(2S,3R,4R,6R)-4-amino-6-hydroxy-2,4-dimethyloxan-3-yl]oxy-2-methyloxan-3-yl] 1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 155545017 |
| Molecular Formula | C18H28N2O6 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | [(2R,3S,6S)-6-[(2S,3R,4R,6R)-4-amino-6-hydroxy-2,4-dimethyloxan-3-yl]oxy-2-methyloxan-3-yl] 1H-pyrrole-2-carboxylate |
| SMILES | C[C@@H]1O[C@@H](O)C[C@@](C)(N)[C@H]1O[C@H]1CC[C@H](OC(=O)c2ccc[nH]2)[C@@H](C)O1 |
| InChI | InChI=1S/C18H28N2O6/c1-10-13(25-17(22)12-5-4-8-20-12)6-7-15(24-10)26-16-11(2)23-14(21)9-18(16,3)19/h4-5,8,10-11,13-16,20-21H,6-7,9,19H2,1-3H3/t10-,11+,13+,14-,15+,16+,18-/m1/s1 |
| InChIKey | JTBMRNJFKYMXNT-WBEMWVTHSA-N |
| XLogP | 1.29 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |