C24H23F3N2O8 — CID 101418318
[1-(4,5-dimethoxy-2-nitrophenyl)-2,2,2-trifluoroethyl] 7-(diethylamino)-2-oxochromene-3-carboxylate (PubChem CID 101418318) has the molecular formula C24H23F3N2O8 and a molecular weight of 524.45 g/mol. Its IUPAC name is [1-(4,5-dimethoxy-2-nitrophenyl)-2,2,2-trifluoroethyl] 7-(diethylamino)-2-oxochromene-3-carboxylate.
| Compound Name | [1-(4,5-dimethoxy-2-nitrophenyl)-2,2,2-trifluoroethyl] 7-(diethylamino)-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 101418318 |
| Molecular Formula | C24H23F3N2O8 |
| Molecular Weight | 524.45 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | [1-(4,5-dimethoxy-2-nitrophenyl)-2,2,2-trifluoroethyl] 7-(diethylamino)-2-oxochromene-3-carboxylate |
| SMILES | CCN(CC)c1ccc2cc(C(=O)OC(c3cc(OC)c(OC)cc3[N+](=O)[O-])C(F)(F)F)c(=O)oc2c1 |
| InChI | InChI=1S/C24H23F3N2O8/c1-5-28(6-2)14-8-7-13-9-16(22(30)36-18(13)10-14)23(31)37-21(24(25,26)27)15-11-19(34-3)20(35-4)12-17(15)29(32)33/h7-12,21H,5-6H2,1-4H3 |
| InChIKey | MRMXZZSIDVZFQB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 121.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|