C23H48OSi — CID 101421066
tert-butyl-dimethyl-(2-methyl-4-methylidene-5-pentyldecan-3-yl)oxysilane (PubChem CID 101421066) has the molecular formula C23H48OSi and a molecular weight of 368.72 g/mol. Its IUPAC name is tert-butyl-dimethyl-(2-methyl-4-methylidene-5-pentyldecan-3-yl)oxysilane.
| Compound Name | tert-butyl-dimethyl-(2-methyl-4-methylidene-5-pentyldecan-3-yl)oxysilane |
|---|---|
| PubChem CID | 101421066 |
| Molecular Formula | C23H48OSi |
| Molecular Weight | 368.72 g/mol |
| Exact Mass | 368.35 |
| IUPAC Name | tert-butyl-dimethyl-(2-methyl-4-methylidene-5-pentyldecan-3-yl)oxysilane |
| SMILES | C=C(C(CCCCC)CCCCC)C(O[Si](C)(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C23H48OSi/c1-11-13-15-17-21(18-16-14-12-2)20(5)22(19(3)4)24-25(9,10)23(6,7)8/h19,21-22H,5,11-18H2,1-4,6-10H3 |
| InChIKey | MCEBILBAJSPOAO-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.72 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|