C26H34FNO6S — CID 10142138
(3E,6S,10S,13R,14S,15S)-3-fluoro-10,14-dihydroxy-11,11,13,15-tetramethyl-6-(2-methyl-1,3-benzothiazol-5-yl)-1,7-dioxacyclohexadec-3-ene-8,12-dione (PubChem CID 10142138) has the molecular formula C26H34FNO6S and a molecular weight of 507.62 g/mol. Its IUPAC name is (3E,6S,10S,13R,14S,15S)-3-fluoro-10,14-dihydroxy-11,11,13,15-tetramethyl-6-(2-methyl-1,3-benzothiazol-5-yl)-1,7-dioxacyclohexadec-3-ene-8,12-dione.
| Compound Name | (3E,6S,10S,13R,14S,15S)-3-fluoro-10,14-dihydroxy-11,11,13,15-tetramethyl-6-(2-methyl-1,3-benzothiazol-5-yl)-1,7-dioxacyclohexadec-3-ene-8,12-dione |
|---|---|
| PubChem CID | 10142138 |
| Molecular Formula | C26H34FNO6S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | (3E,6S,10S,13R,14S,15S)-3-fluoro-10,14-dihydroxy-11,11,13,15-tetramethyl-6-(2-methyl-1,3-benzothiazol-5-yl)-1,7-dioxacyclohexadec-3-ene-8,12-dione |
| SMILES | Cc1nc2cc([C@@H]3C/C=C(/F)COC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O3)ccc2s1 |
| InChI | InChI=1S/C26H34FNO6S/c1-14-12-33-13-18(27)7-8-20(17-6-9-21-19(10-17)28-16(3)35-21)34-23(30)11-22(29)26(4,5)25(32)15(2)24(14)31/h6-7,9-10,14-15,20,22,24,29,31H,8,11-13H2,1-5H3/b18-7+/t14-,15+,20-,22-,24-/m0/s1 |
| InChIKey | JIJSAZAGGRKLLA-BSOMLDOJSA-N |
| XLogP | 4.44 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |