C28H38FNO6S — CID 59890411
(1S,3S,11S,16R)-3-[2-(fluoromethyl)-1,3-benzothiazol-5-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 59890411) has the molecular formula C28H38FNO6S and a molecular weight of 535.68 g/mol. Its IUPAC name is (1S,3S,11S,16R)-3-[2-(fluoromethyl)-1,3-benzothiazol-5-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,11S,16R)-3-[2-(fluoromethyl)-1,3-benzothiazol-5-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 59890411 |
| Molecular Formula | C28H38FNO6S |
| Molecular Weight | 535.68 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | (1S,3S,11S,16R)-3-[2-(fluoromethyl)-1,3-benzothiazol-5-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC1CCC[C@@]2(C)O[C@H]2C[C@@H](c2ccc3sc(CF)nc3c2)OC(=O)CC(O)C(C)(C)C(=O)C(C)[C@H]1O |
| InChI | InChI=1S/C28H38FNO6S/c1-15-7-6-10-28(5)22(36-28)12-19(17-8-9-20-18(11-17)30-23(14-29)37-20)35-24(32)13-21(31)27(3,4)26(34)16(2)25(15)33/h8-9,11,15-16,19,21-22,25,31,33H,6-7,10,12-14H2,1-5H3/t15?,16?,19-,21?,22-,25-,28+/m0/s1 |
| InChIKey | BMKJSKJTEFOPGM-ZQVSVJNQSA-N |
| XLogP | 5.06 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.68 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|