C28H38FNO5S — CID 59890428
(8S,13Z,16S)-16-[2-(fluoromethyl)-1,3-benzothiazol-5-yl]-4,8-dihydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 59890428) has the molecular formula C28H38FNO5S and a molecular weight of 519.68 g/mol. Its IUPAC name is (8S,13Z,16S)-16-[2-(fluoromethyl)-1,3-benzothiazol-5-yl]-4,8-dihydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (8S,13Z,16S)-16-[2-(fluoromethyl)-1,3-benzothiazol-5-yl]-4,8-dihydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 59890428 |
| Molecular Formula | C28H38FNO5S |
| Molecular Weight | 519.68 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | (8S,13Z,16S)-16-[2-(fluoromethyl)-1,3-benzothiazol-5-yl]-4,8-dihydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | C/C1=C/C[C@@H](c2ccc3sc(CF)nc3c2)OC(=O)CC(O)C(C)(C)C(=O)C(C)[C@@H](O)C(C)CCC1 |
| InChI | InChI=1S/C28H38FNO5S/c1-16-7-6-8-17(2)26(33)18(3)27(34)28(4,5)23(31)14-25(32)35-21(11-9-16)19-10-12-22-20(13-19)30-24(15-29)36-22/h9-10,12-13,17-18,21,23,26,31,33H,6-8,11,14-15H2,1-5H3/b16-9-/t17?,18?,21-,23?,26-/m0/s1 |
| InChIKey | MAPOTRVCZAEHLY-NJVGLXFDSA-N |
| XLogP | 5.85 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.68 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|