C25H34N2O3 — CID 101423725
[(2R,3S,6R,7R)-4-benzyl-7-(2,5-dimethoxyphenyl)-2-propan-2-yl-1,4-diazabicyclo[4.2.0]octan-3-yl]methanol (PubChem CID 101423725) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is [(2R,3S,6R,7R)-4-benzyl-7-(2,5-dimethoxyphenyl)-2-propan-2-yl-1,4-diazabicyclo[4.2.0]octan-3-yl]methanol.
| Compound Name | [(2R,3S,6R,7R)-4-benzyl-7-(2,5-dimethoxyphenyl)-2-propan-2-yl-1,4-diazabicyclo[4.2.0]octan-3-yl]methanol |
|---|---|
| PubChem CID | 101423725 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | [(2R,3S,6R,7R)-4-benzyl-7-(2,5-dimethoxyphenyl)-2-propan-2-yl-1,4-diazabicyclo[4.2.0]octan-3-yl]methanol |
| SMILES | COc1ccc(OC)c([C@@H]2CN3[C@H](C(C)C)[C@@H](CO)N(Cc4ccccc4)C[C@@H]23)c1 |
| InChI | InChI=1S/C25H34N2O3/c1-17(2)25-23(16-28)26(13-18-8-6-5-7-9-18)15-22-21(14-27(22)25)20-12-19(29-3)10-11-24(20)30-4/h5-12,17,21-23,25,28H,13-16H2,1-4H3/t21-,22-,23+,25+/m0/s1 |
| InChIKey | FTONURYBHRXPPR-LYGMZBLVSA-N |
| XLogP | 3.37 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |