C31H33NO9 — CID 101426657
(5aR,8aS,9R)-7,9-bis(3,4,5-trimethoxyphenyl)-6,8,8a,9-tetrahydro-5aH-[1,3]benzodioxolo[5,6-f]isoindol-5-one (PubChem CID 101426657) has the molecular formula C31H33NO9 and a molecular weight of 563.60 g/mol. Its IUPAC name is (5aR,8aS,9R)-7,9-bis(3,4,5-trimethoxyphenyl)-6,8,8a,9-tetrahydro-5aH-[1,3]benzodioxolo[5,6-f]isoindol-5-one.
| Compound Name | (5aR,8aS,9R)-7,9-bis(3,4,5-trimethoxyphenyl)-6,8,8a,9-tetrahydro-5aH-[1,3]benzodioxolo[5,6-f]isoindol-5-one |
|---|---|
| PubChem CID | 101426657 |
| Molecular Formula | C31H33NO9 |
| Molecular Weight | 563.60 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | (5aR,8aS,9R)-7,9-bis(3,4,5-trimethoxyphenyl)-6,8,8a,9-tetrahydro-5aH-[1,3]benzodioxolo[5,6-f]isoindol-5-one |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3C(=O)[C@H]3CN(c5cc(OC)c(OC)c(OC)c5)C[C@@H]23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C31H33NO9/c1-34-24-7-16(8-25(35-2)30(24)38-5)28-18-11-22-23(41-15-40-22)12-19(18)29(33)21-14-32(13-20(21)28)17-9-26(36-3)31(39-6)27(10-17)37-4/h7-12,20-21,28H,13-15H2,1-6H3/t20-,21+,28-/m1/s1 |
| InChIKey | OIBPSLFDWPWZBV-PHVLTXCSSA-N |
| XLogP | 4.55 |
| TPSA | 94.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|