C30H21NO3S — CID 101426889
2-(4-oxo-3,5-diphenyl-1,3-thiazolidin-2-ylidene)-1,3-diphenylpropane-1,3-dione (PubChem CID 101426889) has the molecular formula C30H21NO3S and a molecular weight of 475.57 g/mol. Its IUPAC name is 2-(4-oxo-3,5-diphenyl-1,3-thiazolidin-2-ylidene)-1,3-diphenylpropane-1,3-dione.
| Compound Name | 2-(4-oxo-3,5-diphenyl-1,3-thiazolidin-2-ylidene)-1,3-diphenylpropane-1,3-dione |
|---|---|
| PubChem CID | 101426889 |
| Molecular Formula | C30H21NO3S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 2-(4-oxo-3,5-diphenyl-1,3-thiazolidin-2-ylidene)-1,3-diphenylpropane-1,3-dione |
| SMILES | O=C(C(C(=O)c1ccccc1)=C1SC(c2ccccc2)C(=O)N1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H21NO3S/c32-26(21-13-5-1-6-14-21)25(27(33)22-15-7-2-8-16-22)30-31(24-19-11-4-12-20-24)29(34)28(35-30)23-17-9-3-10-18-23/h1-20,28H |
| InChIKey | WCDMEZATMWKKAH-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|