C19H17NO3S — CID 101426893
(2Z)-2-(3-methoxy-2-oxopropylidene)-3,5-diphenyl-1,3-thiazolidin-4-one (PubChem CID 101426893) has the molecular formula C19H17NO3S and a molecular weight of 339.42 g/mol. Its IUPAC name is (2Z)-2-(3-methoxy-2-oxopropylidene)-3,5-diphenyl-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-2-(3-methoxy-2-oxopropylidene)-3,5-diphenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 101426893 |
| Molecular Formula | C19H17NO3S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (2Z)-2-(3-methoxy-2-oxopropylidene)-3,5-diphenyl-1,3-thiazolidin-4-one |
| SMILES | COCC(=O)/C=C1\SC(c2ccccc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C19H17NO3S/c1-23-13-16(21)12-17-20(15-10-6-3-7-11-15)19(22)18(24-17)14-8-4-2-5-9-14/h2-12,18H,13H2,1H3/b17-12- |
| InChIKey | AQTCKBOEISAOFW-ATVHPVEESA-N |
| XLogP | 3.56 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|