C31H34INO4Si — CID 101427274
(4S,5R)-3-[(2S,5S)-3-iodo-5-[(1R)-1-phenylmethoxyethyl]-4-trimethylsilyl-2,5-dihydrofuran-2-yl]-4,5-diphenyl-1,3-oxazolidin-2-one (PubChem CID 101427274) has the molecular formula C31H34INO4Si and a molecular weight of 639.61 g/mol. Its IUPAC name is (4S,5R)-3-[(2S,5S)-3-iodo-5-[(1R)-1-phenylmethoxyethyl]-4-trimethylsilyl-2,5-dihydrofuran-2-yl]-4,5-diphenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-3-[(2S,5S)-3-iodo-5-[(1R)-1-phenylmethoxyethyl]-4-trimethylsilyl-2,5-dihydrofuran-2-yl]-4,5-diphenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101427274 |
| Molecular Formula | C31H34INO4Si |
| Molecular Weight | 639.61 g/mol |
| Exact Mass | 639.13 |
| IUPAC Name | (4S,5R)-3-[(2S,5S)-3-iodo-5-[(1R)-1-phenylmethoxyethyl]-4-trimethylsilyl-2,5-dihydrofuran-2-yl]-4,5-diphenyl-1,3-oxazolidin-2-one |
| SMILES | C[C@@H](OCc1ccccc1)[C@@H]1O[C@H](N2C(=O)O[C@H](c3ccccc3)[C@@H]2c2ccccc2)C(I)=C1[Si](C)(C)C |
| InChI | InChI=1S/C31H34INO4Si/c1-21(35-20-22-14-8-5-9-15-22)27-29(38(2,3)4)25(32)30(36-27)33-26(23-16-10-6-11-17-23)28(37-31(33)34)24-18-12-7-13-19-24/h5-19,21,26-28,30H,20H2,1-4H3/t21-,26+,27+,28-,30+/m1/s1 |
| InChIKey | MZYNWQRUGHYWKG-UAVBNKATSA-N |
| XLogP | 7.82 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.61 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|