C27H29NO2Si — CID 42604161
(4R,5S)-3-[(1S,2S)-2-[benzyl(dimethyl)silyl]cyclopropyl]-4,5-diphenyl-1,3-oxazolidin-2-one (PubChem CID 42604161) has the molecular formula C27H29NO2Si and a molecular weight of 427.62 g/mol. Its IUPAC name is (4R,5S)-3-[(1S,2S)-2-[benzyl(dimethyl)silyl]cyclopropyl]-4,5-diphenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-3-[(1S,2S)-2-[benzyl(dimethyl)silyl]cyclopropyl]-4,5-diphenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 42604161 |
| Molecular Formula | C27H29NO2Si |
| Molecular Weight | 427.62 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | (4R,5S)-3-[(1S,2S)-2-[benzyl(dimethyl)silyl]cyclopropyl]-4,5-diphenyl-1,3-oxazolidin-2-one |
| SMILES | C[Si](C)(Cc1ccccc1)[C@H]1C[C@@H]1N1C(=O)O[C@@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C27H29NO2Si/c1-31(2,19-20-12-6-3-7-13-20)24-18-23(24)28-25(21-14-8-4-9-15-21)26(30-27(28)29)22-16-10-5-11-17-22/h3-17,23-26H,18-19H2,1-2H3/t23-,24-,25+,26-/m0/s1 |
| InChIKey | CSXNGJQJOBAMDY-SSUZURRFSA-N |
| XLogP | 6.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.62 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|