About methyl N-(2,6-dichlorophenyl)-2-methoxy-2-[1-(4-methylphenyl)sulfonylindol-3-yl]ethanimidate
methyl N-(2,6-dichlorophenyl)-2-methoxy-2-[1-(4-methylphenyl)sulfonylindol-3-yl]ethanimidate (PubChem CID 101431627) has the molecular formula C25H22Cl2N2O4S
and a molecular weight of 517.43 g/mol. Its IUPAC name is methyl N-(2,6-dichlorophenyl)-2-methoxy-2-[1-(4-methylphenyl)sulfonylindol-3-yl]ethanimidate.
Molecular Properties
| Compound Name | methyl N-(2,6-dichlorophenyl)-2-methoxy-2-[1-(4-methylphenyl)sulfonylindol-3-yl]ethanimidate |
| PubChem CID | 101431627 |
| Molecular Formula | C25H22Cl2N2O4S |
| Molecular Weight | 517.43 g/mol |
| Exact Mass | 516.07 |
| IUPAC Name | methyl N-(2,6-dichlorophenyl)-2-methoxy-2-[1-(4-methylphenyl)sulfonylindol-3-yl]ethanimidate |
| SMILES | CO/C(=N\c1c(Cl)cccc1Cl)C(OC)c1cn(S(=O)(=O)c2ccc(C)cc2)c2ccccc12 |
| InChI | InChI=1S/C25H22Cl2N2O4S/c1-16-11-13-17(14-12-16)34(30,31)29-15-19(18-7-4-5-10-22(18)29)24(32-2)25(33-3)28-23-20(26)8-6-9-21(23)27/h4-15,24H,1-3H3/b28-25- |
| InChIKey | JUTXRYILDAPSLF-FVDSYPCUSA-N |
| XLogP | 6.56 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 517.43 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N-(2,6-dichlorophenyl)-2-methoxy-2-[1-(4-methylphenyl)sulfonylindol-3-yl]ethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(2,6-dichlorophenyl)-2-methoxy-2-[1-(4-methylphenyl)sulfonylindol-3-yl]ethanimidate?
The IUPAC name of methyl N-(2,6-dichlorophenyl)-2-methoxy-2-[1-(4-methylphenyl)sulfonylindol-3-yl]ethanimidate (CID 101431627) is methyl N-(2,6-dichlorophenyl)-2-methoxy-2-[1-(4-methylphenyl)sulfonylindol-3-yl]ethanimidate.
What is the SMILES notation for methyl N-(2,6-dichlorophenyl)-2-methoxy-2-[1-(4-methylphenyl)sulfonylindol-3-yl]ethanimidate?
The canonical SMILES for methyl N-(2,6-dichlorophenyl)-2-methoxy-2-[1-(4-methylphenyl)sulfonylindol-3-yl]ethanimidate is CO/C(=N\c1c(Cl)cccc1Cl)C(OC)c1cn(S(=O)(=O)c2ccc(C)cc2)c2ccccc12.
What is the InChIKey of methyl N-(2,6-dichlorophenyl)-2-methoxy-2-[1-(4-methylphenyl)sulfonylindol-3-yl]ethanimidate?
The InChIKey is JUTXRYILDAPSLF-FVDSYPCUSA-N. The full InChI is InChI=1S/C25H22Cl2N2O4S/c1-16-11-13-17(14-12-16)34(30,31)29-15-19(18-7-4-5-10-22(18)29)24(32-2)25(33-3)28-23-20(26)8-6-9-21(23)27/h4-15,24H,1-3H3/b28-25-.
What are the key properties of methyl N-(2,6-dichlorophenyl)-2-methoxy-2-[1-(4-methylphenyl)sulfonylindol-3-yl]ethanimidate?
methyl N-(2,6-dichlorophenyl)-2-methoxy-2-[1-(4-methylphenyl)sulfonylindol-3-yl]ethanimidate has a molecular weight of 517.43 g/mol, XLogP of 6.56, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(2,6-dichlorophenyl)-2-methoxy-2-[1-(4-methylphenyl)sulfonylindol-3-yl]ethanimidate is sourced from PubChem (CID 101431627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).