C29H38FNO5S — CID 10143244
(4S,7R,8S,9S,13E,16S)-13-fluoro-4,8-dihydroxy-5,5,9-trimethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-7-prop-2-enyl-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 10143244) has the molecular formula C29H38FNO5S and a molecular weight of 531.69 g/mol. Its IUPAC name is (4S,7R,8S,9S,13E,16S)-13-fluoro-4,8-dihydroxy-5,5,9-trimethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-7-prop-2-enyl-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,13E,16S)-13-fluoro-4,8-dihydroxy-5,5,9-trimethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-7-prop-2-enyl-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 10143244 |
| Molecular Formula | C29H38FNO5S |
| Molecular Weight | 531.69 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | (4S,7R,8S,9S,13E,16S)-13-fluoro-4,8-dihydroxy-5,5,9-trimethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-7-prop-2-enyl-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | C=CC[C@H]1C(=O)C(C)(C)[C@@H](O)CC(=O)O[C@H](c2ccc3sc(C)nc3c2)C/C=C(/F)CCC[C@H](C)[C@@H]1O |
| InChI | InChI=1S/C29H38FNO5S/c1-6-8-21-27(34)17(2)9-7-10-20(30)12-13-23(19-11-14-24-22(15-19)31-18(3)37-24)36-26(33)16-25(32)29(4,5)28(21)35/h6,11-12,14-15,17,21,23,25,27,32,34H,1,7-10,13,16H2,2-5H3/b20-12+/t17-,21+,23-,25-,27-/m0/s1 |
| InChIKey | BTISUNZNSCCPRK-MPGPNWIOSA-N |
| XLogP | 6.15 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.69 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|