C12H18BrNO3 — CID 101433051
tert-butyl (3aR,6S,6aS)-6-bromo-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-1-carboxylate (PubChem CID 101433051) has the molecular formula C12H18BrNO3 and a molecular weight of 304.18 g/mol. Its IUPAC name is tert-butyl (3aR,6S,6aS)-6-bromo-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-1-carboxylate.
| Compound Name | tert-butyl (3aR,6S,6aS)-6-bromo-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 101433051 |
| Molecular Formula | C12H18BrNO3 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | tert-butyl (3aR,6S,6aS)-6-bromo-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C[C@H]2CC[C@H](Br)[C@H]21 |
| InChI | InChI=1S/C12H18BrNO3/c1-12(2,3)17-11(16)14-9(15)6-7-4-5-8(13)10(7)14/h7-8,10H,4-6H2,1-3H3/t7-,8+,10+/m1/s1 |
| InChIKey | AKHGEKCEQCEQRT-WEDXCCLWSA-N |
| XLogP | 2.70 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|