C16H23BrN2O4 — CID 139247452
tert-butyl (3aS,5aR,6R,9aS)-6-bromo-1,4-dioxo-3,3a,5a,6,7,8,9,9a-octahydro-2H-pyrrolo[1,2-a]quinoxaline-5-carboxylate (PubChem CID 139247452) has the molecular formula C16H23BrN2O4 and a molecular weight of 387.27 g/mol. Its IUPAC name is tert-butyl (3aS,5aR,6R,9aS)-6-bromo-1,4-dioxo-3,3a,5a,6,7,8,9,9a-octahydro-2H-pyrrolo[1,2-a]quinoxaline-5-carboxylate.
| Compound Name | tert-butyl (3aS,5aR,6R,9aS)-6-bromo-1,4-dioxo-3,3a,5a,6,7,8,9,9a-octahydro-2H-pyrrolo[1,2-a]quinoxaline-5-carboxylate |
|---|---|
| PubChem CID | 139247452 |
| Molecular Formula | C16H23BrN2O4 |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | tert-butyl (3aS,5aR,6R,9aS)-6-bromo-1,4-dioxo-3,3a,5a,6,7,8,9,9a-octahydro-2H-pyrrolo[1,2-a]quinoxaline-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@@H]2CCC(=O)N2[C@H]2CCC[C@@H](Br)[C@@H]21 |
| InChI | InChI=1S/C16H23BrN2O4/c1-16(2,3)23-15(22)19-13-9(17)5-4-6-10(13)18-11(14(19)21)7-8-12(18)20/h9-11,13H,4-8H2,1-3H3/t9-,10+,11+,13+/m1/s1 |
| InChIKey | FJRFGLCKBAUEOU-BLFANLJRSA-N |
| XLogP | 2.44 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|