C22H26O5 — CID 101435706
ethyl (4S,5R)-5-hydroxy-3-oxo-7-phenyl-4-phenylmethoxyheptanoate (PubChem CID 101435706) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is ethyl (4S,5R)-5-hydroxy-3-oxo-7-phenyl-4-phenylmethoxyheptanoate.
| Compound Name | ethyl (4S,5R)-5-hydroxy-3-oxo-7-phenyl-4-phenylmethoxyheptanoate |
|---|---|
| PubChem CID | 101435706 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | ethyl (4S,5R)-5-hydroxy-3-oxo-7-phenyl-4-phenylmethoxyheptanoate |
| SMILES | CCOC(=O)CC(=O)[C@@H](OCc1ccccc1)[C@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C22H26O5/c1-2-26-21(25)15-20(24)22(27-16-18-11-7-4-8-12-18)19(23)14-13-17-9-5-3-6-10-17/h3-12,19,22-23H,2,13-16H2,1H3/t19-,22+/m1/s1 |
| InChIKey | HKZFOMMLDWARND-KNQAVFIVSA-N |
| XLogP | 3.09 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|